C18H18O5Sn — CID 66765894
dibenzyltin(2+);2-hydroxybutanedioate (PubChem CID 66765894) has the molecular formula C18H18O5Sn and a molecular weight of 433.05 g/mol. Its IUPAC name is dibenzyltin(2+);2-hydroxybutanedioate.
| Compound Name | dibenzyltin(2+);2-hydroxybutanedioate |
|---|---|
| PubChem CID | 66765894 |
| Molecular Formula | C18H18O5Sn |
| Molecular Weight | 433.05 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | dibenzyltin(2+);2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)C(=O)[O-].c1ccc(C[Sn+2]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C7H7.C4H6O5.Sn/c2*1-7-5-3-2-4-6-7;5-2(4(8)9)1-3(6)7;/h2*2-6H,1H2;2,5H,1H2,(H,6,7)(H,8,9);/q;;;+2/p-2 |
| InChIKey | DBSIZGKYJCLVOB-UHFFFAOYSA-L |
| XLogP | -0.67 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.05 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |