C32H30O5Sn — CID 66766072
2-benzyl-2-phenylmethoxybutanedioate;dibenzyltin(2+) (PubChem CID 66766072) has the molecular formula C32H30O5Sn and a molecular weight of 613.30 g/mol. Its IUPAC name is 2-benzyl-2-phenylmethoxybutanedioate;dibenzyltin(2+).
| Compound Name | 2-benzyl-2-phenylmethoxybutanedioate;dibenzyltin(2+) |
|---|---|
| PubChem CID | 66766072 |
| Molecular Formula | C32H30O5Sn |
| Molecular Weight | 613.30 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 2-benzyl-2-phenylmethoxybutanedioate;dibenzyltin(2+) |
| SMILES | O=C([O-])CC(Cc1ccccc1)(OCc1ccccc1)C(=O)[O-].c1ccc(C[Sn+2]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O5.2C7H7.Sn/c19-16(20)12-18(17(21)22,11-14-7-3-1-4-8-14)23-13-15-9-5-2-6-10-15;2*1-7-5-3-2-4-6-7;/h1-10H,11-13H2,(H,19,20)(H,21,22);2*2-6H,1H2;/q;;;+2/p-2 |
| InChIKey | XUCLNSZXCVQMIP-UHFFFAOYSA-L |
| XLogP | 3.17 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |