C23H20O8-2 — CID 22289113
3-methylidene-2,2-bis(2-oxo-2-phenylmethoxyethyl)butanedioate (PubChem CID 22289113) has the molecular formula C23H20O8-2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 3-methylidene-2,2-bis(2-oxo-2-phenylmethoxyethyl)butanedioate.
| Compound Name | 3-methylidene-2,2-bis(2-oxo-2-phenylmethoxyethyl)butanedioate |
|---|---|
| PubChem CID | 22289113 |
| Molecular Formula | C23H20O8-2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-methylidene-2,2-bis(2-oxo-2-phenylmethoxyethyl)butanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)OCc1ccccc1)(CC(=O)OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C23H22O8/c1-16(21(26)27)23(22(28)29,12-19(24)30-14-17-8-4-2-5-9-17)13-20(25)31-15-18-10-6-3-7-11-18/h2-11H,1,12-15H2,(H,26,27)(H,28,29)/p-2 |
| InChIKey | MWRPSCPVVSRKCZ-UHFFFAOYSA-L |
| XLogP | 0.30 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|