C21H18O6-2 — CID 22289588
2-benzyl-3-methylidene-2-[2-(3-methylphenoxy)-2-oxoethyl]butanedioate (PubChem CID 22289588) has the molecular formula C21H18O6-2 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-benzyl-3-methylidene-2-[2-(3-methylphenoxy)-2-oxoethyl]butanedioate.
| Compound Name | 2-benzyl-3-methylidene-2-[2-(3-methylphenoxy)-2-oxoethyl]butanedioate |
|---|---|
| PubChem CID | 22289588 |
| Molecular Formula | C21H18O6-2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-benzyl-3-methylidene-2-[2-(3-methylphenoxy)-2-oxoethyl]butanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)Oc1cccc(C)c1)(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C21H20O6/c1-14-7-6-10-17(11-14)27-18(22)13-21(20(25)26,15(2)19(23)24)12-16-8-4-3-5-9-16/h3-11H,2,12-13H2,1H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | DQDYUJQVXVGNMM-UHFFFAOYSA-L |
| XLogP | 0.58 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|