C17H18O7-2 — CID 22289331
2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate (PubChem CID 22289331) has the molecular formula C17H18O7-2 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate.
| Compound Name | 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 22289331 |
| Molecular Formula | C17H18O7-2 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)OCCOC)(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C17H20O7/c1-12(15(19)20)17(16(21)22,10-13-6-4-3-5-7-13)11-14(18)24-9-8-23-2/h3-7H,1,8-11H2,2H3,(H,19,20)(H,21,22)/p-2 |
| InChIKey | XREDNUOSTLCOND-UHFFFAOYSA-L |
| XLogP | -1.15 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|