C12H12KLiO4 — CID 139411441
lithium;potassium;2-benzyl-2-ethylpropanedioate (PubChem CID 139411441) has the molecular formula C12H12KLiO4 and a molecular weight of 266.26 g/mol. Its IUPAC name is lithium;potassium;2-benzyl-2-ethylpropanedioate.
| Compound Name | lithium;potassium;2-benzyl-2-ethylpropanedioate |
|---|---|
| PubChem CID | 139411441 |
| Molecular Formula | C12H12KLiO4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | lithium;potassium;2-benzyl-2-ethylpropanedioate |
| SMILES | CCC(Cc1ccccc1)(C(=O)[O-])C(=O)[O-].[K+].[Li+] |
| InChI | InChI=1S/C12H14O4.K.Li/c1-2-12(10(13)14,11(15)16)8-9-6-4-3-5-7-9;;/h3-7H,2,8H2,1H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | RUVHVVAWHCQKHT-UHFFFAOYSA-L |
| XLogP | -6.87 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|