About dipotassium;2-benzyl-2-tert-butylpropanedioate
dipotassium;2-benzyl-2-tert-butylpropanedioate (PubChem CID 139412006) has the molecular formula C14H16K2O4
and a molecular weight of 326.47 g/mol. Its IUPAC name is dipotassium;2-benzyl-2-tert-butylpropanedioate.
Molecular Properties
| Compound Name | dipotassium;2-benzyl-2-tert-butylpropanedioate |
| PubChem CID | 139412006 |
| Molecular Formula | C14H16K2O4 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | dipotassium;2-benzyl-2-tert-butylpropanedioate |
| SMILES | CC(C)(C)C(Cc1ccccc1)(C(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C14H18O4.2K/c1-13(2,3)14(11(15)16,12(17)18)9-10-7-5-4-6-8-10;;/h4-8H,9H2,1-3H3,(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | VBLXYQFTZBIFFH-UHFFFAOYSA-L |
| XLogP | -6.23 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | -6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-benzyl-2-tert-butylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-benzyl-2-tert-butylpropanedioate?
The IUPAC name of dipotassium;2-benzyl-2-tert-butylpropanedioate (CID 139412006) is dipotassium;2-benzyl-2-tert-butylpropanedioate.
What is the SMILES notation for dipotassium;2-benzyl-2-tert-butylpropanedioate?
The canonical SMILES for dipotassium;2-benzyl-2-tert-butylpropanedioate is CC(C)(C)C(Cc1ccccc1)(C(=O)[O-])C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-benzyl-2-tert-butylpropanedioate?
The InChIKey is VBLXYQFTZBIFFH-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H18O4.2K/c1-13(2,3)14(11(15)16,12(17)18)9-10-7-5-4-6-8-10;;/h4-8H,9H2,1-3H3,(H,15,16)(H,17,18);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-benzyl-2-tert-butylpropanedioate?
dipotassium;2-benzyl-2-tert-butylpropanedioate has a molecular weight of 326.47 g/mol, XLogP of -6.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-benzyl-2-tert-butylpropanedioate is sourced from PubChem (CID 139412006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).