C20H18O4-2 — CID 23469784
(E)-2,2-dibenzylhex-3-enedioate (PubChem CID 23469784) has the molecular formula C20H18O4-2 and a molecular weight of 322.36 g/mol. Its IUPAC name is (E)-2,2-dibenzylhex-3-enedioate.
| Compound Name | (E)-2,2-dibenzylhex-3-enedioate |
|---|---|
| PubChem CID | 23469784 |
| Molecular Formula | C20H18O4-2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (E)-2,2-dibenzylhex-3-enedioate |
| SMILES | O=C([O-])C/C=C/C(Cc1ccccc1)(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C20H20O4/c21-18(22)12-7-13-20(19(23)24,14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-11,13H,12,14-15H2,(H,21,22)(H,23,24)/p-2/b13-7+ |
| InChIKey | TWZNFFUXSMIEEK-NTUHNPAUSA-L |
| XLogP | 0.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|