C15H20O3 — CID 154135206
2-benzyl-2-ethyl-3-oxohexanoic acid (PubChem CID 154135206) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-benzyl-2-ethyl-3-oxohexanoic acid.
| Compound Name | 2-benzyl-2-ethyl-3-oxohexanoic acid |
|---|---|
| PubChem CID | 154135206 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-benzyl-2-ethyl-3-oxohexanoic acid |
| SMILES | CCCC(=O)C(CC)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20O3/c1-3-8-13(16)15(4-2,14(17)18)11-12-9-6-5-7-10-12/h5-7,9-10H,3-4,8,11H2,1-2H3,(H,17,18) |
| InChIKey | RCBZWLKDWUCMNV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|