C31H30I2O4 — CID 87066824
2,2-diethylpropanedioate;bis(diphenyliodanium) (PubChem CID 87066824) has the molecular formula C31H30I2O4 and a molecular weight of 720.39 g/mol. Its IUPAC name is 2,2-diethylpropanedioate;bis(diphenyliodanium).
| Compound Name | 2,2-diethylpropanedioate;bis(diphenyliodanium) |
|---|---|
| PubChem CID | 87066824 |
| Molecular Formula | C31H30I2O4 |
| Molecular Weight | 720.39 g/mol |
| Exact Mass | 720.02 |
| IUPAC Name | 2,2-diethylpropanedioate;bis(diphenyliodanium) |
| SMILES | CCC(CC)(C(=O)[O-])C(=O)[O-].c1ccc([I+]c2ccccc2)cc1.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10I.C7H12O4/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7(4-2,5(8)9)6(10)11/h2*1-10H;3-4H2,1-2H3,(H,8,9)(H,10,11)/q2*+1;/p-2 |
| InChIKey | RJXIGANAZLBEEL-UHFFFAOYSA-L |
| XLogP | -2.08 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.39 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|