C15H20KNO3 — CID 23672129
potassium 2-ethyl-2-(phenylcarbamoyl)hexanoate (PubChem CID 23672129) has the molecular formula C15H20KNO3 and a molecular weight of 301.43 g/mol. Its IUPAC name is potassium 2-ethyl-2-(phenylcarbamoyl)hexanoate.
| Compound Name | potassium 2-ethyl-2-(phenylcarbamoyl)hexanoate |
|---|---|
| PubChem CID | 23672129 |
| Molecular Formula | C15H20KNO3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | potassium 2-ethyl-2-(phenylcarbamoyl)hexanoate |
| SMILES | CCCCC(CC)(C(=O)[O-])C(=O)Nc1ccccc1.[K+] |
| InChI | InChI=1S/C15H21NO3.K/c1-3-5-11-15(4-2,14(18)19)13(17)16-12-9-7-6-8-10-12;/h6-10H,3-5,11H2,1-2H3,(H,16,17)(H,18,19);/q;+1/p-1 |
| InChIKey | QOXIZMQDQVMBDU-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|