C17H29NOSi — CID 10334484
2-methyl-N-phenyl-2-trimethylsilylheptanamide (PubChem CID 10334484) has the molecular formula C17H29NOSi and a molecular weight of 291.51 g/mol. Its IUPAC name is 2-methyl-N-phenyl-2-trimethylsilylheptanamide.
| Compound Name | 2-methyl-N-phenyl-2-trimethylsilylheptanamide |
|---|---|
| PubChem CID | 10334484 |
| Molecular Formula | C17H29NOSi |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-methyl-N-phenyl-2-trimethylsilylheptanamide |
| SMILES | CCCCCC(C)(C(=O)Nc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C17H29NOSi/c1-6-7-11-14-17(2,20(3,4)5)16(19)18-15-12-9-8-10-13-15/h8-10,12-13H,6-7,11,14H2,1-5H3,(H,18,19) |
| InChIKey | AAXNDTJMGRPODC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|