C15H21Br2NO — CID 59766487
2,2-dibromo-N-phenylnonanamide (PubChem CID 59766487) has the molecular formula C15H21Br2NO and a molecular weight of 391.15 g/mol. Its IUPAC name is 2,2-dibromo-N-phenylnonanamide.
| Compound Name | 2,2-dibromo-N-phenylnonanamide |
|---|---|
| PubChem CID | 59766487 |
| Molecular Formula | C15H21Br2NO |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2,2-dibromo-N-phenylnonanamide |
| SMILES | CCCCCCCC(Br)(Br)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H21Br2NO/c1-2-3-4-5-9-12-15(16,17)14(19)18-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,18,19) |
| InChIKey | NSIJZSOMCQYYAG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|