C25H32N4O4 — CID 134124725
1-N',3-N'-dibenzoyl-2,2-dibutylpropanedihydrazide (PubChem CID 134124725) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-N',3-N'-dibenzoyl-2,2-dibutylpropanedihydrazide.
| Compound Name | 1-N',3-N'-dibenzoyl-2,2-dibutylpropanedihydrazide |
|---|---|
| PubChem CID | 134124725 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-N',3-N'-dibenzoyl-2,2-dibutylpropanedihydrazide |
| SMILES | CCCCC(CCCC)(C(=O)NNC(=O)c1ccccc1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O4/c1-3-5-17-25(18-6-4-2,23(32)28-26-21(30)19-13-9-7-10-14-19)24(33)29-27-22(31)20-15-11-8-12-16-20/h7-16H,3-6,17-18H2,1-2H3,(H,26,30)(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | SNHGBPVKEQXOPB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|