C15H22O10 — CID 22289515
2,2-bis[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid (PubChem CID 22289515) has the molecular formula C15H22O10 and a molecular weight of 362.33 g/mol. Its IUPAC name is 2,2-bis[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid.
| Compound Name | 2,2-bis[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 22289515 |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2,2-bis[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OCCOC)(CC(=O)OCCOC)C(=O)O |
| InChI | InChI=1S/C15H22O10/c1-10(13(18)19)15(14(20)21,8-11(16)24-6-4-22-2)9-12(17)25-7-5-23-3/h1,4-9H2,2-3H3,(H,18,19)(H,20,21) |
| InChIKey | BFZSSJFMEJVZIY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|