C12H16O7-2 — CID 22289137
2-(2-ethoxy-2-oxoethyl)-2-(2-methoxyethyl)-3-methylidenebutanedioate (PubChem CID 22289137) has the molecular formula C12H16O7-2 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-2-(2-methoxyethyl)-3-methylidenebutanedioate.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-2-(2-methoxyethyl)-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 22289137 |
| Molecular Formula | C12H16O7-2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-2-(2-methoxyethyl)-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CCOC)(CC(=O)OCC)C(=O)[O-] |
| InChI | InChI=1S/C12H18O7/c1-4-19-9(13)7-12(11(16)17,5-6-18-3)8(2)10(14)15/h2,4-7H2,1,3H3,(H,14,15)(H,16,17)/p-2 |
| InChIKey | WGMHIESDCHQMQO-UHFFFAOYSA-L |
| XLogP | -1.98 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|