C16H22O7-2 — CID 22289502
2-cyclohexyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate (PubChem CID 22289502) has the molecular formula C16H22O7-2 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-cyclohexyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate.
| Compound Name | 2-cyclohexyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 22289502 |
| Molecular Formula | C16H22O7-2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-cyclohexyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(=O)OCCOC)(C(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C16H24O7/c1-11(14(18)19)16(15(20)21,12-6-4-3-5-7-12)10-13(17)23-9-8-22-2/h12H,1,3-10H2,2H3,(H,18,19)(H,20,21)/p-2 |
| InChIKey | YDTIVIKMMNVPDF-UHFFFAOYSA-L |
| XLogP | -0.81 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|