C13H18O7-2 — CID 22289159
2-[2-(2-ethoxyethoxy)-2-oxoethyl]-2-ethyl-3-methylidenebutanedioate (PubChem CID 22289159) has the molecular formula C13H18O7-2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)-2-oxoethyl]-2-ethyl-3-methylidenebutanedioate.
| Compound Name | 2-[2-(2-ethoxyethoxy)-2-oxoethyl]-2-ethyl-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 22289159 |
| Molecular Formula | C13H18O7-2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)-2-oxoethyl]-2-ethyl-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)[O-])C(CC)(CC(=O)OCCOCC)C(=O)[O-] |
| InChI | InChI=1S/C13H20O7/c1-4-13(12(17)18,9(3)11(15)16)8-10(14)20-7-6-19-5-2/h3-8H2,1-2H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | QOZJJJHYPIEFLI-UHFFFAOYSA-L |
| XLogP | -1.59 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|