C15H22O6-2 — CID 22289221
2-(2-ethoxyethyl)-3-methylidene-2-(2-oxohexyl)butanedioate (PubChem CID 22289221) has the molecular formula C15H22O6-2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-3-methylidene-2-(2-oxohexyl)butanedioate.
| Compound Name | 2-(2-ethoxyethyl)-3-methylidene-2-(2-oxohexyl)butanedioate |
|---|---|
| PubChem CID | 22289221 |
| Molecular Formula | C15H22O6-2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-(2-ethoxyethyl)-3-methylidene-2-(2-oxohexyl)butanedioate |
| SMILES | C=C(C(=O)[O-])C(CCOCC)(CC(=O)CCCC)C(=O)[O-] |
| InChI | InChI=1S/C15H24O6/c1-4-6-7-12(16)10-15(14(19)20,8-9-21-5-2)11(3)13(17)18/h3-10H2,1-2H3,(H,17,18)(H,19,20)/p-2 |
| InChIKey | NCAGJGNJEXWNSL-UHFFFAOYSA-L |
| XLogP | -0.40 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|