C16H24O5-2 — CID 22289341
2-(2-ethylhexyl)-3-methylidene-2-(2-oxopropyl)butanedioate (PubChem CID 22289341) has the molecular formula C16H24O5-2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-3-methylidene-2-(2-oxopropyl)butanedioate.
| Compound Name | 2-(2-ethylhexyl)-3-methylidene-2-(2-oxopropyl)butanedioate |
|---|---|
| PubChem CID | 22289341 |
| Molecular Formula | C16H24O5-2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(2-ethylhexyl)-3-methylidene-2-(2-oxopropyl)butanedioate |
| SMILES | C=C(C(=O)[O-])C(CC(C)=O)(CC(CC)CCCC)C(=O)[O-] |
| InChI | InChI=1S/C16H26O5/c1-5-7-8-13(6-2)10-16(15(20)21,9-11(3)17)12(4)14(18)19/h13H,4-10H2,1-3H3,(H,18,19)(H,20,21)/p-2 |
| InChIKey | DLOFJLWVUZYXGI-UHFFFAOYSA-L |
| XLogP | 0.61 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|