C16H26O6 — CID 22289581
2-(2-ethylhexyl)-2-(2-methoxy-2-oxoethyl)-3-methylidenebutanedioic acid (PubChem CID 22289581) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-2-(2-methoxy-2-oxoethyl)-3-methylidenebutanedioic acid.
| Compound Name | 2-(2-ethylhexyl)-2-(2-methoxy-2-oxoethyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 22289581 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-(2-ethylhexyl)-2-(2-methoxy-2-oxoethyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OC)(CC(CC)CCCC)C(=O)O |
| InChI | InChI=1S/C16H26O6/c1-5-7-8-12(6-2)9-16(15(20)21,10-13(17)22-4)11(3)14(18)19/h12H,3,5-10H2,1-2,4H3,(H,18,19)(H,20,21) |
| InChIKey | CSAULABUUBQLQB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|