C30H50O6 — CID 88742098
2-butyl-4-(1-carboxyethenyl)-4,6-bis(2-ethylhexyl)hepta-2,5-dienedioic acid (PubChem CID 88742098) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is 2-butyl-4-(1-carboxyethenyl)-4,6-bis(2-ethylhexyl)hepta-2,5-dienedioic acid.
| Compound Name | 2-butyl-4-(1-carboxyethenyl)-4,6-bis(2-ethylhexyl)hepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 88742098 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 2-butyl-4-(1-carboxyethenyl)-4,6-bis(2-ethylhexyl)hepta-2,5-dienedioic acid |
| SMILES | C=C(C(=O)O)C(C=C(CCCC)C(=O)O)(C=C(CC(CC)CCCC)C(=O)O)CC(CC)CCCC |
| InChI | InChI=1S/C30H50O6/c1-7-12-15-23(10-4)18-26(29(35)36)21-30(22(6)27(31)32,19-24(11-5)16-13-8-2)20-25(28(33)34)17-14-9-3/h20-21,23-24H,6-19H2,1-5H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | OGNJGINJXUNJPZ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|