C23H36O8 — CID 88637073
4-butyl-4-(1-carboxyethenyl)-2-(3-ethoxypropyl)-6-(3-methoxypropyl)hepta-2,5-dienedioic acid (PubChem CID 88637073) has the molecular formula C23H36O8 and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-butyl-4-(1-carboxyethenyl)-2-(3-ethoxypropyl)-6-(3-methoxypropyl)hepta-2,5-dienedioic acid.
| Compound Name | 4-butyl-4-(1-carboxyethenyl)-2-(3-ethoxypropyl)-6-(3-methoxypropyl)hepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 88637073 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4-butyl-4-(1-carboxyethenyl)-2-(3-ethoxypropyl)-6-(3-methoxypropyl)hepta-2,5-dienedioic acid |
| SMILES | C=C(C(=O)O)C(C=C(CCCOC)C(=O)O)(C=C(CCCOCC)C(=O)O)CCCC |
| InChI | InChI=1S/C23H36O8/c1-5-7-12-23(17(3)20(24)25,15-18(21(26)27)10-8-13-30-4)16-19(22(28)29)11-9-14-31-6-2/h15-16H,3,5-14H2,1-2,4H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | LQXNWCCYJKWHKU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|