C20H31NO6 — CID 88837023
4-(3-butoxy-3-oxoprop-1-en-2-yl)-4-[2-(dimethylamino)ethyl]-2,6-dimethylhepta-2,5-dienedioic acid (PubChem CID 88837023) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is 4-(3-butoxy-3-oxoprop-1-en-2-yl)-4-[2-(dimethylamino)ethyl]-2,6-dimethylhepta-2,5-dienedioic acid.
| Compound Name | 4-(3-butoxy-3-oxoprop-1-en-2-yl)-4-[2-(dimethylamino)ethyl]-2,6-dimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 88837023 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-(3-butoxy-3-oxoprop-1-en-2-yl)-4-[2-(dimethylamino)ethyl]-2,6-dimethylhepta-2,5-dienedioic acid |
| SMILES | C=C(C(=O)OCCCC)C(C=C(C)C(=O)O)(C=C(C)C(=O)O)CCN(C)C |
| InChI | InChI=1S/C20H31NO6/c1-7-8-11-27-19(26)16(4)20(9-10-21(5)6,12-14(2)17(22)23)13-15(3)18(24)25/h12-13H,4,7-11H2,1-3,5-6H3,(H,22,23)(H,24,25) |
| InChIKey | PKFANXZZILQXSC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|