C12H20O5 — CID 157279487
(Z)-2-(3-methoxypropyl)but-2-enedioic acid;2-methylprop-1-ene (PubChem CID 157279487) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (Z)-2-(3-methoxypropyl)but-2-enedioic acid;2-methylprop-1-ene.
| Compound Name | (Z)-2-(3-methoxypropyl)but-2-enedioic acid;2-methylprop-1-ene |
|---|---|
| PubChem CID | 157279487 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (Z)-2-(3-methoxypropyl)but-2-enedioic acid;2-methylprop-1-ene |
| SMILES | C=C(C)C.COCCC/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O5.C4H8/c1-13-4-2-3-6(8(11)12)5-7(9)10;1-4(2)3/h5H,2-4H2,1H3,(H,9,10)(H,11,12);1H2,2-3H3/b6-5-; |
| InChIKey | AZMLQGOCQYEBKF-YSMBQZINSA-N |
| XLogP | 2.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|