C12H14O9 — CID 54393958
2-[2-[2-(carboxymethylidene)-4-hydroxybutanoyl]oxyethyl]but-2-enedioic acid (PubChem CID 54393958) has the molecular formula C12H14O9 and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethylidene)-4-hydroxybutanoyl]oxyethyl]but-2-enedioic acid.
| Compound Name | 2-[2-[2-(carboxymethylidene)-4-hydroxybutanoyl]oxyethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 54393958 |
| Molecular Formula | C12H14O9 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[2-[2-(carboxymethylidene)-4-hydroxybutanoyl]oxyethyl]but-2-enedioic acid |
| SMILES | O=C(O)C=C(CCOC(=O)C(=CC(=O)O)CCO)C(=O)O |
| InChI | InChI=1S/C12H14O9/c13-3-1-8(6-10(16)17)12(20)21-4-2-7(11(18)19)5-9(14)15/h5-6,13H,1-4H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | VIPQZMQYYFRZGY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|