C10H14O7 — CID 141375851
(E)-2-(2-propan-2-yloxycarbonyloxyethyl)but-2-enedioic acid (PubChem CID 141375851) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is (E)-2-(2-propan-2-yloxycarbonyloxyethyl)but-2-enedioic acid.
| Compound Name | (E)-2-(2-propan-2-yloxycarbonyloxyethyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 141375851 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (E)-2-(2-propan-2-yloxycarbonyloxyethyl)but-2-enedioic acid |
| SMILES | CC(C)OC(=O)OCC/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O7/c1-6(2)17-10(15)16-4-3-7(9(13)14)5-8(11)12/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/b7-5+ |
| InChIKey | ZGHTYMXCIHBDRP-FNORWQNLSA-N |
| XLogP | 1.03 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|