C16H24O8 — CID 159117399
(Z)-4-butoxy-4-oxobut-2-enoic acid;(Z)-2-butylbut-2-enedioic acid (PubChem CID 159117399) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is (Z)-4-butoxy-4-oxobut-2-enoic acid;(Z)-2-butylbut-2-enedioic acid.
| Compound Name | (Z)-4-butoxy-4-oxobut-2-enoic acid;(Z)-2-butylbut-2-enedioic acid |
|---|---|
| PubChem CID | 159117399 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (Z)-4-butoxy-4-oxobut-2-enoic acid;(Z)-2-butylbut-2-enedioic acid |
| SMILES | CCCC/C(=C/C(=O)O)C(=O)O.CCCCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/2C8H12O4/c1-2-3-6-12-8(11)5-4-7(9)10;1-2-3-4-6(8(11)12)5-7(9)10/h4-5H,2-3,6H2,1H3,(H,9,10);5H,2-4H2,1H3,(H,9,10)(H,11,12)/b5-4-;6-5- |
| InChIKey | KFGKGBIBPMRFSY-REEYZRKBSA-N |
| XLogP | 2.24 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|