About propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate
propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate (PubChem CID 90011533) has the molecular formula C12H22O8S
and a molecular weight of 326.37 g/mol. Its IUPAC name is propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate.
Molecular Properties
| Compound Name | propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate |
| PubChem CID | 90011533 |
| Molecular Formula | C12H22O8S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate |
| SMILES | CC(C)OC(=O)OCCS(=O)(=O)CCOC(=O)OC(C)C |
| InChI | InChI=1S/C12H22O8S/c1-9(2)19-11(13)17-5-7-21(15,16)8-6-18-12(14)20-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | NRERFIFDVOPDJY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate?
The IUPAC name of propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate (CID 90011533) is propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate.
What is the SMILES notation for propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate?
The canonical SMILES for propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate is CC(C)OC(=O)OCCS(=O)(=O)CCOC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate?
The InChIKey is NRERFIFDVOPDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O8S/c1-9(2)19-11(13)17-5-7-21(15,16)8-6-18-12(14)20-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate?
propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate has a molecular weight of 326.37 g/mol, XLogP of 1.52, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(2-propan-2-yloxycarbonyloxyethylsulfonyl)ethyl carbonate is sourced from PubChem (CID 90011533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).