C19H32O10S2 — CID 171762771
2-[3-[2-(2-methylpropanoyloxy)ethylsulfonyl]-2-(2-methylprop-2-enoyloxy)propyl]sulfonylethyl 2-methylpropanoate (PubChem CID 171762771) has the molecular formula C19H32O10S2 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[3-[2-(2-methylpropanoyloxy)ethylsulfonyl]-2-(2-methylprop-2-enoyloxy)propyl]sulfonylethyl 2-methylpropanoate.
| Compound Name | 2-[3-[2-(2-methylpropanoyloxy)ethylsulfonyl]-2-(2-methylprop-2-enoyloxy)propyl]sulfonylethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171762771 |
| Molecular Formula | C19H32O10S2 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[3-[2-(2-methylpropanoyloxy)ethylsulfonyl]-2-(2-methylprop-2-enoyloxy)propyl]sulfonylethyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OC(CS(=O)(=O)CCOC(=O)C(C)C)CS(=O)(=O)CCOC(=O)C(C)C |
| InChI | InChI=1S/C19H32O10S2/c1-13(2)17(20)27-7-9-30(23,24)11-16(29-19(22)15(5)6)12-31(25,26)10-8-28-18(21)14(3)4/h13-14,16H,5,7-12H2,1-4,6H3 |
| InChIKey | ILDWPSMFTURBMU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|