About (1-hydroxycyclopropyl)methyl propan-2-yl carbonate
(1-hydroxycyclopropyl)methyl propan-2-yl carbonate (PubChem CID 141497433) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is (1-hydroxycyclopropyl)methyl propan-2-yl carbonate.
Molecular Properties
| Compound Name | (1-hydroxycyclopropyl)methyl propan-2-yl carbonate |
| PubChem CID | 141497433 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (1-hydroxycyclopropyl)methyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCC1(O)CC1 |
| InChI | InChI=1S/C8H14O4/c1-6(2)12-7(9)11-5-8(10)3-4-8/h6,10H,3-5H2,1-2H3 |
| InChIKey | IOIGHQJJTSOPLF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-hydroxycyclopropyl)methyl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxycyclopropyl)methyl propan-2-yl carbonate?
The IUPAC name of (1-hydroxycyclopropyl)methyl propan-2-yl carbonate (CID 141497433) is (1-hydroxycyclopropyl)methyl propan-2-yl carbonate.
What is the SMILES notation for (1-hydroxycyclopropyl)methyl propan-2-yl carbonate?
The canonical SMILES for (1-hydroxycyclopropyl)methyl propan-2-yl carbonate is CC(C)OC(=O)OCC1(O)CC1.
What is the InChIKey of (1-hydroxycyclopropyl)methyl propan-2-yl carbonate?
The InChIKey is IOIGHQJJTSOPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-6(2)12-7(9)11-5-8(10)3-4-8/h6,10H,3-5H2,1-2H3.
What are the key properties of (1-hydroxycyclopropyl)methyl propan-2-yl carbonate?
(1-hydroxycyclopropyl)methyl propan-2-yl carbonate has a molecular weight of 174.20 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxycyclopropyl)methyl propan-2-yl carbonate is sourced from PubChem (CID 141497433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).