C10H19Cl3O6 — CID 160742921
chloromethyl carbonochloridate;chloromethyl propan-2-yl carbonate;propan-2-ol (PubChem CID 160742921) has the molecular formula C10H19Cl3O6 and a molecular weight of 341.62 g/mol. Its IUPAC name is chloromethyl carbonochloridate;chloromethyl propan-2-yl carbonate;propan-2-ol.
| Compound Name | chloromethyl carbonochloridate;chloromethyl propan-2-yl carbonate;propan-2-ol |
|---|---|
| PubChem CID | 160742921 |
| Molecular Formula | C10H19Cl3O6 |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | chloromethyl carbonochloridate;chloromethyl propan-2-yl carbonate;propan-2-ol |
| SMILES | CC(C)O.CC(C)OC(=O)OCCl.O=C(Cl)OCCl |
| InChI | InChI=1S/C5H9ClO3.C3H8O.C2H2Cl2O2/c1-4(2)9-5(7)8-3-6;1-3(2)4;3-1-6-2(4)5/h4H,3H2,1-2H3;3-4H,1-2H3;1H2 |
| InChIKey | RVVATXUHDBAECT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|