About (1-aminocycloheptyl)methyl propan-2-yl carbonate
(1-aminocycloheptyl)methyl propan-2-yl carbonate (PubChem CID 79337960) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is (1-aminocycloheptyl)methyl propan-2-yl carbonate.
Molecular Properties
| Compound Name | (1-aminocycloheptyl)methyl propan-2-yl carbonate |
| PubChem CID | 79337960 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (1-aminocycloheptyl)methyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCC1(N)CCCCCC1 |
| InChI | InChI=1S/C12H23NO3/c1-10(2)16-11(14)15-9-12(13)7-5-3-4-6-8-12/h10H,3-9,13H2,1-2H3 |
| InChIKey | MGYXCCHNCKNEPS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-aminocycloheptyl)methyl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocycloheptyl)methyl propan-2-yl carbonate?
The IUPAC name of (1-aminocycloheptyl)methyl propan-2-yl carbonate (CID 79337960) is (1-aminocycloheptyl)methyl propan-2-yl carbonate.
What is the SMILES notation for (1-aminocycloheptyl)methyl propan-2-yl carbonate?
The canonical SMILES for (1-aminocycloheptyl)methyl propan-2-yl carbonate is CC(C)OC(=O)OCC1(N)CCCCCC1.
What is the InChIKey of (1-aminocycloheptyl)methyl propan-2-yl carbonate?
The InChIKey is MGYXCCHNCKNEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-10(2)16-11(14)15-9-12(13)7-5-3-4-6-8-12/h10H,3-9,13H2,1-2H3.
What are the key properties of (1-aminocycloheptyl)methyl propan-2-yl carbonate?
(1-aminocycloheptyl)methyl propan-2-yl carbonate has a molecular weight of 229.32 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocycloheptyl)methyl propan-2-yl carbonate is sourced from PubChem (CID 79337960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).