C9H16O5 — CID 162012493
2-methoxyethyl acetate;2-methylprop-2-enoic acid (PubChem CID 162012493) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-methoxyethyl acetate;2-methylprop-2-enoic acid.
| Compound Name | 2-methoxyethyl acetate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 162012493 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-methoxyethyl acetate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.COCCOC(C)=O |
| InChI | InChI=1S/C5H10O3.C4H6O2/c1-5(6)8-4-3-7-2;1-3(2)4(5)6/h3-4H2,1-2H3;1H2,2H3,(H,5,6) |
| InChIKey | YTQUWLGYDFXHBU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|