C22H30O6 — CID 22289292
2-(2-ethylhexyl)-3-methylidene-2-(2-oxo-2-phenylmethoxyethyl)butanedioic acid (PubChem CID 22289292) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-3-methylidene-2-(2-oxo-2-phenylmethoxyethyl)butanedioic acid.
| Compound Name | 2-(2-ethylhexyl)-3-methylidene-2-(2-oxo-2-phenylmethoxyethyl)butanedioic acid |
|---|---|
| PubChem CID | 22289292 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-(2-ethylhexyl)-3-methylidene-2-(2-oxo-2-phenylmethoxyethyl)butanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OCc1ccccc1)(CC(CC)CCCC)C(=O)O |
| InChI | InChI=1S/C22H30O6/c1-4-6-10-17(5-2)13-22(21(26)27,16(3)20(24)25)14-19(23)28-15-18-11-8-7-9-12-18/h7-9,11-12,17H,3-6,10,13-15H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | SSKREKNPYQHWQX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|