C17H20O7 — CID 22289332
2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid (PubChem CID 22289332) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid.
| Compound Name | 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 22289332 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-benzyl-2-[2-(2-methoxyethoxy)-2-oxoethyl]-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OCCOC)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H20O7/c1-12(15(19)20)17(16(21)22,10-13-6-4-3-5-7-13)11-14(18)24-9-8-23-2/h3-7H,1,8-11H2,2H3,(H,19,20)(H,21,22) |
| InChIKey | XREDNUOSTLCOND-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|