C19H30O10 — CID 22289675
3-methylidene-2,2-bis[2-oxo-2-(2-propoxyethoxy)ethyl]butanedioic acid (PubChem CID 22289675) has the molecular formula C19H30O10 and a molecular weight of 418.44 g/mol. Its IUPAC name is 3-methylidene-2,2-bis[2-oxo-2-(2-propoxyethoxy)ethyl]butanedioic acid.
| Compound Name | 3-methylidene-2,2-bis[2-oxo-2-(2-propoxyethoxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 22289675 |
| Molecular Formula | C19H30O10 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-methylidene-2,2-bis[2-oxo-2-(2-propoxyethoxy)ethyl]butanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OCCOCCC)(CC(=O)OCCOCCC)C(=O)O |
| InChI | InChI=1S/C19H30O10/c1-4-6-26-8-10-28-15(20)12-19(18(24)25,14(3)17(22)23)13-16(21)29-11-9-27-7-5-2/h3-13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | SUZISSDCSMFSKG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|