C13H16O8 — CID 90808547
2-[2-(2-methylprop-2-enoyloxy)ethyl]but-3-ene-1,2,3-tricarboxylic acid (PubChem CID 90808547) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethyl]but-3-ene-1,2,3-tricarboxylic acid.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethyl]but-3-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 90808547 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethyl]but-3-ene-1,2,3-tricarboxylic acid |
| SMILES | C=C(C)C(=O)OCCC(CC(=O)O)(C(=C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H16O8/c1-7(2)11(18)21-5-4-13(12(19)20,6-9(14)15)8(3)10(16)17/h1,3-6H2,2H3,(H,14,15)(H,16,17)(H,19,20) |
| InChIKey | QTZJEBOKAPCEFN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|