C12H18O6 — CID 22289074
2-(2-methoxyethyl)-3-methylidene-2-(2-oxobutyl)butanedioic acid (PubChem CID 22289074) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-3-methylidene-2-(2-oxobutyl)butanedioic acid.
| Compound Name | 2-(2-methoxyethyl)-3-methylidene-2-(2-oxobutyl)butanedioic acid |
|---|---|
| PubChem CID | 22289074 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(2-methoxyethyl)-3-methylidene-2-(2-oxobutyl)butanedioic acid |
| SMILES | C=C(C(=O)O)C(CCOC)(CC(=O)CC)C(=O)O |
| InChI | InChI=1S/C12H18O6/c1-4-9(13)7-12(11(16)17,5-6-18-3)8(2)10(14)15/h2,4-7H2,1,3H3,(H,14,15)(H,16,17) |
| InChIKey | VKPBFKUKQZYUMK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|