C17H26O6 — CID 22289247
2-(2-cyclohexyl-2-oxoethyl)-2-(2-ethoxyethyl)-3-methylidenebutanedioic acid (PubChem CID 22289247) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-(2-cyclohexyl-2-oxoethyl)-2-(2-ethoxyethyl)-3-methylidenebutanedioic acid.
| Compound Name | 2-(2-cyclohexyl-2-oxoethyl)-2-(2-ethoxyethyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 22289247 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-(2-cyclohexyl-2-oxoethyl)-2-(2-ethoxyethyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CCOCC)(CC(=O)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C17H26O6/c1-3-23-10-9-17(16(21)22,12(2)15(19)20)11-14(18)13-7-5-4-6-8-13/h13H,2-11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YTZUTOHCIDFYEO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|