C17H26O10 — CID 22289360
2,2-bis[1-(2-methoxyethoxy)-1-oxopropan-2-yl]-3-methylidenebutanedioic acid (PubChem CID 22289360) has the molecular formula C17H26O10 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2,2-bis[1-(2-methoxyethoxy)-1-oxopropan-2-yl]-3-methylidenebutanedioic acid.
| Compound Name | 2,2-bis[1-(2-methoxyethoxy)-1-oxopropan-2-yl]-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 22289360 |
| Molecular Formula | C17H26O10 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2,2-bis[1-(2-methoxyethoxy)-1-oxopropan-2-yl]-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(C(=O)O)(C(C)C(=O)OCCOC)C(C)C(=O)OCCOC |
| InChI | InChI=1S/C17H26O10/c1-10(13(18)19)17(16(22)23,11(2)14(20)26-8-6-24-4)12(3)15(21)27-9-7-25-5/h11-12H,1,6-9H2,2-5H3,(H,18,19)(H,22,23) |
| InChIKey | JFNYGEMOIVDGHC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|