C12H20O7 — CID 175833181
2-(2-methoxyethoxy)prop-2-enoic acid;2-methoxyethyl prop-2-enoate (PubChem CID 175833181) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)prop-2-enoic acid;2-methoxyethyl prop-2-enoate.
| Compound Name | 2-(2-methoxyethoxy)prop-2-enoic acid;2-methoxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 175833181 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(2-methoxyethoxy)prop-2-enoic acid;2-methoxyethyl prop-2-enoate |
| SMILES | C=C(OCCOC)C(=O)O.C=CC(=O)OCCOC |
| InChI | InChI=1S/C6H10O4.C6H10O3/c1-5(6(7)8)10-4-3-9-2;1-3-6(7)9-5-4-8-2/h1,3-4H2,2H3,(H,7,8);3H,1,4-5H2,2H3 |
| InChIKey | RBFMIEZOJVCSJH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|