C10H14O8P- — CID 22226175
bis(2-prop-2-enoyloxyethyl) phosphate (PubChem CID 22226175) has the molecular formula C10H14O8P- and a molecular weight of 293.19 g/mol. Its IUPAC name is bis(2-prop-2-enoyloxyethyl) phosphate.
| Compound Name | bis(2-prop-2-enoyloxyethyl) phosphate |
|---|---|
| PubChem CID | 22226175 |
| Molecular Formula | C10H14O8P- |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | bis(2-prop-2-enoyloxyethyl) phosphate |
| SMILES | C=CC(=O)OCCOP(=O)([O-])OCCOC(=O)C=C |
| InChI | InChI=1S/C10H15O8P/c1-3-9(11)15-5-7-17-19(13,14)18-8-6-16-10(12)4-2/h3-4H,1-2,5-8H2,(H,13,14)/p-1 |
| InChIKey | WAJJFPMYKWCDNI-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|