C5H7MgO6P — CID 174879443
magnesium 2-prop-2-enoyloxyethyl phosphate (PubChem CID 174879443) has the molecular formula C5H7MgO6P and a molecular weight of 218.38 g/mol. Its IUPAC name is magnesium 2-prop-2-enoyloxyethyl phosphate.
| Compound Name | magnesium 2-prop-2-enoyloxyethyl phosphate |
|---|---|
| PubChem CID | 174879443 |
| Molecular Formula | C5H7MgO6P |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | magnesium 2-prop-2-enoyloxyethyl phosphate |
| SMILES | C=CC(=O)OCCOP(=O)([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C5H9O6P.Mg/c1-2-5(6)10-3-4-11-12(7,8)9;/h2H,1,3-4H2,(H2,7,8,9);/q;+2/p-2 |
| InChIKey | PWQWGTASWRQFKL-UHFFFAOYSA-L |
| XLogP | -1.82 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|