C15H21O10P — CID 13205776
2-[bis(2-prop-2-enoyloxyethoxy)phosphoryloxy]ethyl prop-2-enoate (PubChem CID 13205776) has the molecular formula C15H21O10P and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-[bis(2-prop-2-enoyloxyethoxy)phosphoryloxy]ethyl prop-2-enoate.
| Compound Name | 2-[bis(2-prop-2-enoyloxyethoxy)phosphoryloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 13205776 |
| Molecular Formula | C15H21O10P |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[bis(2-prop-2-enoyloxyethoxy)phosphoryloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOP(=O)(OCCOC(=O)C=C)OCCOC(=O)C=C |
| InChI | InChI=1S/C15H21O10P/c1-4-13(16)20-7-10-23-26(19,24-11-8-21-14(17)5-2)25-12-9-22-15(18)6-3/h4-6H,1-3,7-12H2 |
| InChIKey | YQZZHMXSIYMFDK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|