C10H15O7P — CID 87504188
2-prop-2-enoyloxyethoxy(2-prop-2-enoyloxyethyl)phosphinic acid (PubChem CID 87504188) has the molecular formula C10H15O7P and a molecular weight of 278.20 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethoxy(2-prop-2-enoyloxyethyl)phosphinic acid.
| Compound Name | 2-prop-2-enoyloxyethoxy(2-prop-2-enoyloxyethyl)phosphinic acid |
|---|---|
| PubChem CID | 87504188 |
| Molecular Formula | C10H15O7P |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-prop-2-enoyloxyethoxy(2-prop-2-enoyloxyethyl)phosphinic acid |
| SMILES | C=CC(=O)OCCOP(=O)(O)CCOC(=O)C=C |
| InChI | InChI=1S/C10H15O7P/c1-3-9(11)15-5-6-17-18(13,14)8-7-16-10(12)4-2/h3-4H,1-2,5-8H2,(H,13,14) |
| InChIKey | ZWJHTNNWNBISPY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|