C11H20NaO9P — CID 172740430
sodium 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl hydrogen phosphate (PubChem CID 172740430) has the molecular formula C11H20NaO9P and a molecular weight of 350.24 g/mol. Its IUPAC name is sodium 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl hydrogen phosphate.
| Compound Name | sodium 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 172740430 |
| Molecular Formula | C11H20NaO9P |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | sodium 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl hydrogen phosphate |
| SMILES | C=CC(=O)OCCOCCOCCOCCOP(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C11H21O9P.Na/c1-2-11(12)19-9-7-17-5-3-16-4-6-18-8-10-20-21(13,14)15;/h2H,1,3-10H2,(H2,13,14,15);/q;+1/p-1 |
| InChIKey | JAFTXEDQZAOTQR-UHFFFAOYSA-M |
| XLogP | -3.75 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|