C8H16NO6P — CID 137354332
2-prop-2-enoyloxyethyl (trimethylazaniumyl) phosphate (PubChem CID 137354332) has the molecular formula C8H16NO6P and a molecular weight of 253.19 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl (trimethylazaniumyl) phosphate.
| Compound Name | 2-prop-2-enoyloxyethyl (trimethylazaniumyl) phosphate |
|---|---|
| PubChem CID | 137354332 |
| Molecular Formula | C8H16NO6P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-prop-2-enoyloxyethyl (trimethylazaniumyl) phosphate |
| SMILES | C=CC(=O)OCCOP(=O)([O-])O[N+](C)(C)C |
| InChI | InChI=1S/C8H16NO6P/c1-5-8(10)13-6-7-14-16(11,12)15-9(2,3)4/h5H,1,6-7H2,2-4H3 |
| InChIKey | DDTMBPXLPUCPGR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|