C9H18NO5P — CID 172841486
2-[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]ethyl-hydroxyphosphinate (PubChem CID 172841486) has the molecular formula C9H18NO5P and a molecular weight of 251.22 g/mol. Its IUPAC name is 2-[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]ethyl-hydroxyphosphinate.
| Compound Name | 2-[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]ethyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 172841486 |
| Molecular Formula | C9H18NO5P |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]ethyl-hydroxyphosphinate |
| SMILES | C=CC(=O)OCC[N+](C)(C)CCP(=O)([O-])O |
| InChI | InChI=1S/C9H18NO5P/c1-4-9(11)15-7-5-10(2,3)6-8-16(12,13)14/h4H,1,5-8H2,2-3H3,(H-,12,13,14) |
| InChIKey | WVTVMCPCZHIAJY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|