About sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate
sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate (PubChem CID 157078576) has the molecular formula C7H14NaO7P
and a molecular weight of 264.15 g/mol. Its IUPAC name is sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate.
Molecular Properties
| Compound Name | sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate |
| PubChem CID | 157078576 |
| Molecular Formula | C7H14NaO7P |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate |
| SMILES | C=CC(=O)OCCCC[O-].O=P(O)(O)O.[Na+] |
| InChI | InChI=1S/C7H11O3.Na.H3O4P/c1-2-7(9)10-6-4-3-5-8;;1-5(2,3)4/h2H,1,3-6H2;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | QMAXTOJEYXYJSE-UHFFFAOYSA-N |
| XLogP | -4.07 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate?
The IUPAC name of sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate (CID 157078576) is sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate.
What is the SMILES notation for sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate?
The canonical SMILES for sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate is C=CC(=O)OCCCC[O-].O=P(O)(O)O.[Na+].
What is the InChIKey of sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate?
The InChIKey is QMAXTOJEYXYJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O3.Na.H3O4P/c1-2-7(9)10-6-4-3-5-8;;1-5(2,3)4/h2H,1,3-6H2;;(H3,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate?
sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate has a molecular weight of 264.15 g/mol, XLogP of -4.07, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;phosphoric acid;4-prop-2-enoyloxybutan-1-olate is sourced from PubChem (CID 157078576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).